C26H24ClN9O2 — CID 20703393
[1-[13-[(3-chloro-4-methoxyphenyl)methylamino]-5-ethyl-4,5,7,11,12-pentazatricyclo[7.4.0.02,6]trideca-1,3,6,8,10,12-hexaen-10-yl]imidazol-4-yl]-(2,5-dihydropyrrol-1-yl)methanone (PubChem CID 20703393) has the molecular formula C26H24ClN9O2 and a molecular weight of 529.99 g/mol. Its IUPAC name is [1-[13-[(3-chloro-4-methoxyphenyl)methylamino]-5-ethyl-4,5,7,11,12-pentazatricyclo[7.4.0.02,6]trideca-1,3,6,8,10,12-hexaen-10-yl]imidazol-4-yl]-(2,5-dihydropyrrol-1-yl)methanone.
| Compound Name | [1-[13-[(3-chloro-4-methoxyphenyl)methylamino]-5-ethyl-4,5,7,11,12-pentazatricyclo[7.4.0.02,6]trideca-1,3,6,8,10,12-hexaen-10-yl]imidazol-4-yl]-(2,5-dihydropyrrol-1-yl)methanone |
|---|---|
| PubChem CID | 20703393 |
| Molecular Formula | C26H24ClN9O2 |
| Molecular Weight | 529.99 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | [1-[13-[(3-chloro-4-methoxyphenyl)methylamino]-5-ethyl-4,5,7,11,12-pentazatricyclo[7.4.0.02,6]trideca-1,3,6,8,10,12-hexaen-10-yl]imidazol-4-yl]-(2,5-dihydropyrrol-1-yl)methanone |
| SMILES | CCn1ncc2c3c(NCc4ccc(OC)c(Cl)c4)nnc(-n4cnc(C(=O)N5CC=CC5)c4)c3cnc21 |
| InChI | InChI=1S/C26H24ClN9O2/c1-3-36-24-18(13-31-36)22-17(12-29-24)25(35-14-20(30-15-35)26(37)34-8-4-5-9-34)33-32-23(22)28-11-16-6-7-21(38-2)19(27)10-16/h4-7,10,12-15H,3,8-9,11H2,1-2H3,(H,28,32) |
| InChIKey | YSGHXVNFTIUUPT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 115.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.99 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|