C28H18ClF5N8O3 — CID 20703430
(2,3,4,5,6-pentafluorophenyl) 1-[13-[(3-chloro-4-methoxyphenyl)methylamino]-5-ethyl-4,5,7,11,12-pentazatricyclo[7.4.0.02,6]trideca-1,3,6,8,10,12-hexaen-10-yl]imidazole-4-carboxylate (PubChem CID 20703430) has the molecular formula C28H18ClF5N8O3 and a molecular weight of 644.95 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 1-[13-[(3-chloro-4-methoxyphenyl)methylamino]-5-ethyl-4,5,7,11,12-pentazatricyclo[7.4.0.02,6]trideca-1,3,6,8,10,12-hexaen-10-yl]imidazole-4-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 1-[13-[(3-chloro-4-methoxyphenyl)methylamino]-5-ethyl-4,5,7,11,12-pentazatricyclo[7.4.0.02,6]trideca-1,3,6,8,10,12-hexaen-10-yl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 20703430 |
| Molecular Formula | C28H18ClF5N8O3 |
| Molecular Weight | 644.95 g/mol |
| Exact Mass | 644.11 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 1-[13-[(3-chloro-4-methoxyphenyl)methylamino]-5-ethyl-4,5,7,11,12-pentazatricyclo[7.4.0.02,6]trideca-1,3,6,8,10,12-hexaen-10-yl]imidazole-4-carboxylate |
| SMILES | CCn1ncc2c3c(NCc4ccc(OC)c(Cl)c4)nnc(-n4cnc(C(=O)Oc5c(F)c(F)c(F)c(F)c5F)c4)c3cnc21 |
| InChI | InChI=1S/C28H18ClF5N8O3/c1-3-42-26-14(9-38-42)18-13(8-36-26)27(40-39-25(18)35-7-12-4-5-17(44-2)15(29)6-12)41-10-16(37-11-41)28(43)45-24-22(33)20(31)19(30)21(32)23(24)34/h4-6,8-11H,3,7H2,1-2H3,(H,35,39) |
| InChIKey | ACAKICRLDNJJGZ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 121.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.95 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|