About N'-ethoxyethanimidamide
N'-ethoxyethanimidamide (PubChem CID 20703486) has the molecular formula C4H10N2O
and a molecular weight of 102.14 g/mol. Its IUPAC name is N'-ethoxyethanimidamide.
Molecular Properties
| Compound Name | N'-ethoxyethanimidamide |
| PubChem CID | 20703486 |
| Molecular Formula | C4H10N2O |
| Molecular Weight | 102.14 g/mol |
| Exact Mass | 102.08 |
| IUPAC Name | N'-ethoxyethanimidamide |
| SMILES | CCO/N=C(\C)N |
| InChI | InChI=1S/C4H10N2O/c1-3-7-6-4(2)5/h3H2,1-2H3,(H2,5,6) |
| InChIKey | WHELQCFYMJNODI-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.14 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-ethoxyethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethoxyethanimidamide?
The IUPAC name of N'-ethoxyethanimidamide (CID 20703486) is N'-ethoxyethanimidamide.
What is the SMILES notation for N'-ethoxyethanimidamide?
The canonical SMILES for N'-ethoxyethanimidamide is CCO/N=C(\C)N.
What is the InChIKey of N'-ethoxyethanimidamide?
The InChIKey is WHELQCFYMJNODI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O/c1-3-7-6-4(2)5/h3H2,1-2H3,(H2,5,6).
What are the key properties of N'-ethoxyethanimidamide?
N'-ethoxyethanimidamide has a molecular weight of 102.14 g/mol, XLogP of 0.31, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethoxyethanimidamide is sourced from PubChem (CID 20703486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).