C33H27N2P — CID 20705055
[2-[(4S,5S)-4,5-diphenyl-4,5-dihydro-1H-imidazol-2-yl]phenyl]-diphenylphosphane (PubChem CID 20705055) has the molecular formula C33H27N2P and a molecular weight of 482.57 g/mol. Its IUPAC name is [2-[(4S,5S)-4,5-diphenyl-4,5-dihydro-1H-imidazol-2-yl]phenyl]-diphenylphosphane.
| Compound Name | [2-[(4S,5S)-4,5-diphenyl-4,5-dihydro-1H-imidazol-2-yl]phenyl]-diphenylphosphane |
|---|---|
| PubChem CID | 20705055 |
| Molecular Formula | C33H27N2P |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | [2-[(4S,5S)-4,5-diphenyl-4,5-dihydro-1H-imidazol-2-yl]phenyl]-diphenylphosphane |
| SMILES | c1ccc([C@@H]2N=C(c3ccccc3P(c3ccccc3)c3ccccc3)N[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C33H27N2P/c1-5-15-25(16-6-1)31-32(26-17-7-2-8-18-26)35-33(34-31)29-23-13-14-24-30(29)36(27-19-9-3-10-20-27)28-21-11-4-12-22-28/h1-24,31-32H,(H,34,35)/t31-,32-/m0/s1 |
| InChIKey | BEHRTCMNHMQAFX-ACHIHNKUSA-N |
| XLogP | 6.28 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|