About 3-N-ethyl-2-N,2-N-dimethyl-3-N-[(1-methylpiperidin-4-yl)methyl]butane-2,3-diamine
3-N-ethyl-2-N,2-N-dimethyl-3-N-[(1-methylpiperidin-4-yl)methyl]butane-2,3-diamine (PubChem CID 20705066) has the molecular formula C15H33N3
and a molecular weight of 255.45 g/mol. Its IUPAC name is 3-N-ethyl-2-N,2-N-dimethyl-3-N-[(1-methylpiperidin-4-yl)methyl]butane-2,3-diamine.
Molecular Properties
| Compound Name | 3-N-ethyl-2-N,2-N-dimethyl-3-N-[(1-methylpiperidin-4-yl)methyl]butane-2,3-diamine |
| PubChem CID | 20705066 |
| Molecular Formula | C15H33N3 |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.27 |
| IUPAC Name | 3-N-ethyl-2-N,2-N-dimethyl-3-N-[(1-methylpiperidin-4-yl)methyl]butane-2,3-diamine |
| SMILES | CCN(CC1CCN(C)CC1)C(C)C(C)N(C)C |
| InChI | InChI=1S/C15H33N3/c1-7-18(14(3)13(2)16(4)5)12-15-8-10-17(6)11-9-15/h13-15H,7-12H2,1-6H3 |
| InChIKey | WMBYAYXHJFLLBA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-N-ethyl-2-N,2-N-dimethyl-3-N-[(1-methylpiperidin-4-yl)methyl]butane-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-ethyl-2-N,2-N-dimethyl-3-N-[(1-methylpiperidin-4-yl)methyl]butane-2,3-diamine?
The IUPAC name of 3-N-ethyl-2-N,2-N-dimethyl-3-N-[(1-methylpiperidin-4-yl)methyl]butane-2,3-diamine (CID 20705066) is 3-N-ethyl-2-N,2-N-dimethyl-3-N-[(1-methylpiperidin-4-yl)methyl]butane-2,3-diamine.
What is the SMILES notation for 3-N-ethyl-2-N,2-N-dimethyl-3-N-[(1-methylpiperidin-4-yl)methyl]butane-2,3-diamine?
The canonical SMILES for 3-N-ethyl-2-N,2-N-dimethyl-3-N-[(1-methylpiperidin-4-yl)methyl]butane-2,3-diamine is CCN(CC1CCN(C)CC1)C(C)C(C)N(C)C.
What is the InChIKey of 3-N-ethyl-2-N,2-N-dimethyl-3-N-[(1-methylpiperidin-4-yl)methyl]butane-2,3-diamine?
The InChIKey is WMBYAYXHJFLLBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H33N3/c1-7-18(14(3)13(2)16(4)5)12-15-8-10-17(6)11-9-15/h13-15H,7-12H2,1-6H3.
What are the key properties of 3-N-ethyl-2-N,2-N-dimethyl-3-N-[(1-methylpiperidin-4-yl)methyl]butane-2,3-diamine?
3-N-ethyl-2-N,2-N-dimethyl-3-N-[(1-methylpiperidin-4-yl)methyl]butane-2,3-diamine has a molecular weight of 255.45 g/mol, XLogP of 1.99, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-ethyl-2-N,2-N-dimethyl-3-N-[(1-methylpiperidin-4-yl)methyl]butane-2,3-diamine is sourced from PubChem (CID 20705066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).