About 1-N,3-N,5-trimethylcyclohexane-1,3-diamine
1-N,3-N,5-trimethylcyclohexane-1,3-diamine (PubChem CID 20705171) has the molecular formula C9H20N2
and a molecular weight of 156.27 g/mol. Its IUPAC name is 1-N,3-N,5-trimethylcyclohexane-1,3-diamine.
Molecular Properties
| Compound Name | 1-N,3-N,5-trimethylcyclohexane-1,3-diamine |
| PubChem CID | 20705171 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | 1-N,3-N,5-trimethylcyclohexane-1,3-diamine |
| SMILES | CNC1CC(C)CC(NC)C1 |
| InChI | InChI=1S/C9H20N2/c1-7-4-8(10-2)6-9(5-7)11-3/h7-11H,4-6H2,1-3H3 |
| InChIKey | NIGATBAYQSLBQC-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-N,3-N,5-trimethylcyclohexane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,3-N,5-trimethylcyclohexane-1,3-diamine?
The IUPAC name of 1-N,3-N,5-trimethylcyclohexane-1,3-diamine (CID 20705171) is 1-N,3-N,5-trimethylcyclohexane-1,3-diamine.
What is the SMILES notation for 1-N,3-N,5-trimethylcyclohexane-1,3-diamine?
The canonical SMILES for 1-N,3-N,5-trimethylcyclohexane-1,3-diamine is CNC1CC(C)CC(NC)C1.
What is the InChIKey of 1-N,3-N,5-trimethylcyclohexane-1,3-diamine?
The InChIKey is NIGATBAYQSLBQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2/c1-7-4-8(10-2)6-9(5-7)11-3/h7-11H,4-6H2,1-3H3.
What are the key properties of 1-N,3-N,5-trimethylcyclohexane-1,3-diamine?
1-N,3-N,5-trimethylcyclohexane-1,3-diamine has a molecular weight of 156.27 g/mol, XLogP of 0.98, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,3-N,5-trimethylcyclohexane-1,3-diamine is sourced from PubChem (CID 20705171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).