C11H22AcO2 — CID 20705969
actinium;2,3,3,5,5,6-hexamethyloxan-4-ol (PubChem CID 20705969) has the molecular formula C11H22AcO2 and a molecular weight of 413.30 g/mol. Its IUPAC name is actinium;2,3,3,5,5,6-hexamethyloxan-4-ol.
| Compound Name | actinium;2,3,3,5,5,6-hexamethyloxan-4-ol |
|---|---|
| PubChem CID | 20705969 |
| Molecular Formula | C11H22AcO2 |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | actinium;2,3,3,5,5,6-hexamethyloxan-4-ol |
| SMILES | CC1OC(C)C(C)(C)C(O)C1(C)C.[Ac] |
| InChI | InChI=1S/C11H22O2.Ac/c1-7-10(3,4)9(12)11(5,6)8(2)13-7;/h7-9,12H,1-6H3; |
| InChIKey | GBVIGWYGTWPYPR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |