C18H22 — CID 20706158
(9S,13S,14R)-13-methyl-6,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene (PubChem CID 20706158) has the molecular formula C18H22 and a molecular weight of 238.37 g/mol. Its IUPAC name is (9S,13S,14R)-13-methyl-6,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene.
| Compound Name | (9S,13S,14R)-13-methyl-6,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 20706158 |
| Molecular Formula | C18H22 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | (9S,13S,14R)-13-methyl-6,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene |
| SMILES | C[C@@]12CCC[C@H]1C1=CCc3ccccc3[C@H]1CC2 |
| InChI | InChI=1S/C18H22/c1-18-11-4-7-17(18)16-9-8-13-5-2-3-6-14(13)15(16)10-12-18/h2-3,5-6,9,15,17H,4,7-8,10-12H2,1H3/t15-,17+,18+/m1/s1 |
| InChIKey | QYPZVMURFZJTTN-NJAFHUGGSA-N |
| XLogP | 4.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|