C11H15NO — CID 20706175
8-methyl-3,4,5,6-tetrahydro-2H-1,5-benzoxazocine (PubChem CID 20706175) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 8-methyl-3,4,5,6-tetrahydro-2H-1,5-benzoxazocine.
| Compound Name | 8-methyl-3,4,5,6-tetrahydro-2H-1,5-benzoxazocine |
|---|---|
| PubChem CID | 20706175 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 8-methyl-3,4,5,6-tetrahydro-2H-1,5-benzoxazocine |
| SMILES | Cc1ccc2c(c1)CNCCCO2 |
| InChI | InChI=1S/C11H15NO/c1-9-3-4-11-10(7-9)8-12-5-2-6-13-11/h3-4,7,12H,2,5-6,8H2,1H3 |
| InChIKey | KFSYTIOWPYIARH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |