C13H28N2O — CID 20706495
1,1-dimethyl-3-(5,5,6-trimethylheptyl)urea (PubChem CID 20706495) has the molecular formula C13H28N2O and a molecular weight of 228.38 g/mol. Its IUPAC name is 1,1-dimethyl-3-(5,5,6-trimethylheptyl)urea.
| Compound Name | 1,1-dimethyl-3-(5,5,6-trimethylheptyl)urea |
|---|---|
| PubChem CID | 20706495 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | 1,1-dimethyl-3-(5,5,6-trimethylheptyl)urea |
| SMILES | CC(C)C(C)(C)CCCCNC(=O)N(C)C |
| InChI | InChI=1S/C13H28N2O/c1-11(2)13(3,4)9-7-8-10-14-12(16)15(5)6/h11H,7-10H2,1-6H3,(H,14,16) |
| InChIKey | UJCJSSXRLBLRBB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|