C11H25NOS — CID 20706633
3,3,4,4-tetramethyl-N-(methyl-methylidene-oxo-λ6-sulfanyl)pentan-1-amine (PubChem CID 20706633) has the molecular formula C11H25NOS and a molecular weight of 219.39 g/mol. Its IUPAC name is 3,3,4,4-tetramethyl-N-(methyl-methylidene-oxo-λ6-sulfanyl)pentan-1-amine.
| Compound Name | 3,3,4,4-tetramethyl-N-(methyl-methylidene-oxo-λ6-sulfanyl)pentan-1-amine |
|---|---|
| PubChem CID | 20706633 |
| Molecular Formula | C11H25NOS |
| Molecular Weight | 219.39 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 3,3,4,4-tetramethyl-N-(methyl-methylidene-oxo-λ6-sulfanyl)pentan-1-amine |
| SMILES | C=S(C)(=O)NCCC(C)(C)C(C)(C)C |
| InChI | InChI=1S/C11H25NOS/c1-10(2,3)11(4,5)8-9-12-14(6,7)13/h6,8-9H2,1-5,7H3,(H,12,13) |
| InChIKey | XCIHZMKJLRJTNK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|