methyl N-(3,3,4,4-tetramethylpentyl)carbamate

C11H23NO2 — CID 20706649

IUPACmethyl N-(3,3,4,4-tetramethylpentyl)carbamate
SMILESCOC(=O)NCCC(C)(C)C(C)(C)C
InChIInChI=1S/C11H23NO2/c1-10(2,3)11(4,5)7-8-12-9(13)14-6/h7-8H2,1-6H3,(H,12,13)
InChIKeyGNWXZPALLSHKBD-UHFFFAOYSA-N
MW201.31 g/mol
LogP2.80
Rot. Bonds3

About methyl N-(3,3,4,4-tetramethylpentyl)carbamate

methyl N-(3,3,4,4-tetramethylpentyl)carbamate (PubChem CID 20706649) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is methyl N-(3,3,4,4-tetramethylpentyl)carbamate.

Molecular Properties

Compound Namemethyl N-(3,3,4,4-tetramethylpentyl)carbamate
PubChem CID20706649
Molecular FormulaC11H23NO2
Molecular Weight201.31 g/mol
Exact Mass201.17
IUPAC Namemethyl N-(3,3,4,4-tetramethylpentyl)carbamate
SMILESCOC(=O)NCCC(C)(C)C(C)(C)C
InChIInChI=1S/C11H23NO2/c1-10(2,3)11(4,5)7-8-12-9(13)14-6/h7-8H2,1-6H3,(H,12,13)
InChIKeyGNWXZPALLSHKBD-UHFFFAOYSA-N
XLogP2.80
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.31
LogP ≤ 52.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze methyl N-(3,3,4,4-tetramethylpentyl)carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl N-(3,3,4,4-tetramethylpentyl)carbamate?
The IUPAC name of methyl N-(3,3,4,4-tetramethylpentyl)carbamate (CID 20706649) is methyl N-(3,3,4,4-tetramethylpentyl)carbamate.
What is the SMILES notation for methyl N-(3,3,4,4-tetramethylpentyl)carbamate?
The canonical SMILES for methyl N-(3,3,4,4-tetramethylpentyl)carbamate is COC(=O)NCCC(C)(C)C(C)(C)C.
What is the InChIKey of methyl N-(3,3,4,4-tetramethylpentyl)carbamate?
The InChIKey is GNWXZPALLSHKBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO2/c1-10(2,3)11(4,5)7-8-12-9(13)14-6/h7-8H2,1-6H3,(H,12,13).
What are the key properties of methyl N-(3,3,4,4-tetramethylpentyl)carbamate?
methyl N-(3,3,4,4-tetramethylpentyl)carbamate has a molecular weight of 201.31 g/mol, XLogP of 2.80, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(3,3,4,4-tetramethylpentyl)carbamate is sourced from PubChem (CID 20706649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).