C12H27NO2S — CID 20706688
N-(5,5,6,6-tetramethylheptyl)methanesulfonamide (PubChem CID 20706688) has the molecular formula C12H27NO2S and a molecular weight of 249.42 g/mol. Its IUPAC name is N-(5,5,6,6-tetramethylheptyl)methanesulfonamide.
| Compound Name | N-(5,5,6,6-tetramethylheptyl)methanesulfonamide |
|---|---|
| PubChem CID | 20706688 |
| Molecular Formula | C12H27NO2S |
| Molecular Weight | 249.42 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | N-(5,5,6,6-tetramethylheptyl)methanesulfonamide |
| SMILES | CC(C)(C)C(C)(C)CCCCNS(C)(=O)=O |
| InChI | InChI=1S/C12H27NO2S/c1-11(2,3)12(4,5)9-7-8-10-13-16(6,14)15/h13H,7-10H2,1-6H3 |
| InChIKey | RGMJFWNFWHGEQJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|