About N-(5,5,6-trimethylheptyl)methanesulfonamide
N-(5,5,6-trimethylheptyl)methanesulfonamide (PubChem CID 20706689) has the molecular formula C11H25NO2S
and a molecular weight of 235.39 g/mol. Its IUPAC name is N-(5,5,6-trimethylheptyl)methanesulfonamide.
Molecular Properties
| Compound Name | N-(5,5,6-trimethylheptyl)methanesulfonamide |
| PubChem CID | 20706689 |
| Molecular Formula | C11H25NO2S |
| Molecular Weight | 235.39 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | N-(5,5,6-trimethylheptyl)methanesulfonamide |
| SMILES | CC(C)C(C)(C)CCCCNS(C)(=O)=O |
| InChI | InChI=1S/C11H25NO2S/c1-10(2)11(3,4)8-6-7-9-12-15(5,13)14/h10,12H,6-9H2,1-5H3 |
| InChIKey | NLNREBVYOJSFEQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(5,5,6-trimethylheptyl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5,5,6-trimethylheptyl)methanesulfonamide?
The IUPAC name of N-(5,5,6-trimethylheptyl)methanesulfonamide (CID 20706689) is N-(5,5,6-trimethylheptyl)methanesulfonamide.
What is the SMILES notation for N-(5,5,6-trimethylheptyl)methanesulfonamide?
The canonical SMILES for N-(5,5,6-trimethylheptyl)methanesulfonamide is CC(C)C(C)(C)CCCCNS(C)(=O)=O.
What is the InChIKey of N-(5,5,6-trimethylheptyl)methanesulfonamide?
The InChIKey is NLNREBVYOJSFEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25NO2S/c1-10(2)11(3,4)8-6-7-9-12-15(5,13)14/h10,12H,6-9H2,1-5H3.
What are the key properties of N-(5,5,6-trimethylheptyl)methanesulfonamide?
N-(5,5,6-trimethylheptyl)methanesulfonamide has a molecular weight of 235.39 g/mol, XLogP of 2.39, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5,5,6-trimethylheptyl)methanesulfonamide is sourced from PubChem (CID 20706689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).