C24H45O5P3 — CID 20707021
7-(diphosphanyloxy)-4,4,6,8-tetramethyl-11-[2-methyl-3-[(E)-3-methylpent-3-enyl]oxiran-2-yl]-5-oxo-3-phosphanyloxyundecanal (PubChem CID 20707021) has the molecular formula C24H45O5P3 and a molecular weight of 506.54 g/mol. Its IUPAC name is 7-(diphosphanyloxy)-4,4,6,8-tetramethyl-11-[2-methyl-3-[(E)-3-methylpent-3-enyl]oxiran-2-yl]-5-oxo-3-phosphanyloxyundecanal.
| Compound Name | 7-(diphosphanyloxy)-4,4,6,8-tetramethyl-11-[2-methyl-3-[(E)-3-methylpent-3-enyl]oxiran-2-yl]-5-oxo-3-phosphanyloxyundecanal |
|---|---|
| PubChem CID | 20707021 |
| Molecular Formula | C24H45O5P3 |
| Molecular Weight | 506.54 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | 7-(diphosphanyloxy)-4,4,6,8-tetramethyl-11-[2-methyl-3-[(E)-3-methylpent-3-enyl]oxiran-2-yl]-5-oxo-3-phosphanyloxyundecanal |
| SMILES | C/C=C(\C)CCC1OC1(C)CCCC(C)C(OPP)C(C)C(=O)C(C)(C)C(CC=O)OP |
| InChI | InChI=1S/C24H45O5P3/c1-8-16(2)11-12-20-24(7,27-20)14-9-10-17(3)21(29-32-31)18(4)22(26)23(5,6)19(28-30)13-15-25/h8,15,17-21,32H,9-14,30-31H2,1-7H3/b16-8+ |
| InChIKey | XKIKPZTXCALCOR-LZYBPNLTSA-N |
| XLogP | 6.46 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.54 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|