C15H21BrMg — CID 20707165
magnesium;1,1,4,4,7-pentamethyl-3,6-dihydro-2H-naphthalen-6-ide;bromide (PubChem CID 20707165) has the molecular formula C15H21BrMg and a molecular weight of 305.54 g/mol. Its IUPAC name is magnesium;1,1,4,4,7-pentamethyl-3,6-dihydro-2H-naphthalen-6-ide;bromide.
| Compound Name | magnesium;1,1,4,4,7-pentamethyl-3,6-dihydro-2H-naphthalen-6-ide;bromide |
|---|---|
| PubChem CID | 20707165 |
| Molecular Formula | C15H21BrMg |
| Molecular Weight | 305.54 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | magnesium;1,1,4,4,7-pentamethyl-3,6-dihydro-2H-naphthalen-6-ide;bromide |
| SMILES | Cc1[c-]cc2c(c1)C(C)(C)CCC2(C)C.[Br-].[Mg+2] |
| InChI | InChI=1S/C15H21.BrH.Mg/c1-11-6-7-12-13(10-11)15(4,5)9-8-14(12,2)3;;/h7,10H,8-9H2,1-5H3;1H;/q-1;;+2/p-1 |
| InChIKey | ZHQQIVDYQLMXDA-UHFFFAOYSA-M |
| XLogP | 0.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.54 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|