About methyl 6-(oxomethyl)pyridine-3-carboxylate;nickel;praseodymium
methyl 6-(oxomethyl)pyridine-3-carboxylate;nickel;praseodymium (PubChem CID 20707169) has the molecular formula C8H6NNiO3Pr2-
and a molecular weight of 504.65 g/mol. Its IUPAC name is methyl 6-(oxomethyl)pyridine-3-carboxylate;nickel;praseodymium.
Molecular Properties
| Compound Name | methyl 6-(oxomethyl)pyridine-3-carboxylate;nickel;praseodymium |
| PubChem CID | 20707169 |
| Molecular Formula | C8H6NNiO3Pr2- |
| Molecular Weight | 504.65 g/mol |
| Exact Mass | 503.79 |
| IUPAC Name | methyl 6-(oxomethyl)pyridine-3-carboxylate;nickel;praseodymium |
| SMILES | COC(=O)c1ccc([C-]=O)nc1.[Ni].[Pr].[Pr] |
| InChI | InChI=1S/C8H6NO3.Ni.2Pr/c1-12-8(11)6-2-3-7(5-10)9-4-6;;;/h2-4H,1H3;;;/q-1;;; |
| InChIKey | RGJMUQFKFMVMAA-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 504.65 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-(oxomethyl)pyridine-3-carboxylate;nickel;praseodymium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-(oxomethyl)pyridine-3-carboxylate;nickel;praseodymium?
The IUPAC name of methyl 6-(oxomethyl)pyridine-3-carboxylate;nickel;praseodymium (CID 20707169) is methyl 6-(oxomethyl)pyridine-3-carboxylate;nickel;praseodymium.
What is the SMILES notation for methyl 6-(oxomethyl)pyridine-3-carboxylate;nickel;praseodymium?
The canonical SMILES for methyl 6-(oxomethyl)pyridine-3-carboxylate;nickel;praseodymium is COC(=O)c1ccc([C-]=O)nc1.[Ni].[Pr].[Pr].
What is the InChIKey of methyl 6-(oxomethyl)pyridine-3-carboxylate;nickel;praseodymium?
The InChIKey is RGJMUQFKFMVMAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6NO3.Ni.2Pr/c1-12-8(11)6-2-3-7(5-10)9-4-6;;;/h2-4H,1H3;;;/q-1;;;.
What are the key properties of methyl 6-(oxomethyl)pyridine-3-carboxylate;nickel;praseodymium?
methyl 6-(oxomethyl)pyridine-3-carboxylate;nickel;praseodymium has a molecular weight of 504.65 g/mol, XLogP of 0.32, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-(oxomethyl)pyridine-3-carboxylate;nickel;praseodymium is sourced from PubChem (CID 20707169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).