C25H36O7 — CID 20707345
3-[10-(dimethoxymethyl)-5-(4-methyl-2,5-dioxooxolan-3-yl)-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl]-2,2-dimethylpropanoic acid (PubChem CID 20707345) has the molecular formula C25H36O7 and a molecular weight of 448.56 g/mol. Its IUPAC name is 3-[10-(dimethoxymethyl)-5-(4-methyl-2,5-dioxooxolan-3-yl)-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[10-(dimethoxymethyl)-5-(4-methyl-2,5-dioxooxolan-3-yl)-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 20707345 |
| Molecular Formula | C25H36O7 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 3-[10-(dimethoxymethyl)-5-(4-methyl-2,5-dioxooxolan-3-yl)-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl]-2,2-dimethylpropanoic acid |
| SMILES | COC(OC)C1CC2CC1C1C3CC(C(C4C(=O)OC(=O)C4C)C3CC(C)(C)C(=O)O)C21 |
| InChI | InChI=1S/C25H36O7/c1-10-17(22(27)32-21(10)26)20-15-8-13(16(20)9-25(2,3)24(28)29)19-12-6-11(18(15)19)7-14(12)23(30-4)31-5/h10-20,23H,6-9H2,1-5H3,(H,28,29) |
| InChIKey | AOQWYZAOUDQNGO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|