C35H56O9 — CID 20707346
3-[10-[6,10-dihydroxyundecan-2-yloxy(methoxy)methyl]-5-(4-methyl-2,5-dioxooxolan-3-yl)-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl]-2,2-dimethylpropanoic acid (PubChem CID 20707346) has the molecular formula C35H56O9 and a molecular weight of 620.82 g/mol. Its IUPAC name is 3-[10-[6,10-dihydroxyundecan-2-yloxy(methoxy)methyl]-5-(4-methyl-2,5-dioxooxolan-3-yl)-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[10-[6,10-dihydroxyundecan-2-yloxy(methoxy)methyl]-5-(4-methyl-2,5-dioxooxolan-3-yl)-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 20707346 |
| Molecular Formula | C35H56O9 |
| Molecular Weight | 620.82 g/mol |
| Exact Mass | 620.39 |
| IUPAC Name | 3-[10-[6,10-dihydroxyundecan-2-yloxy(methoxy)methyl]-5-(4-methyl-2,5-dioxooxolan-3-yl)-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl]-2,2-dimethylpropanoic acid |
| SMILES | COC(OC(C)CCCC(O)CCCC(C)O)C1CC2CC1C1C3CC(C(C4C(=O)OC(=O)C4C)C3CC(C)(C)C(=O)O)C21 |
| InChI | InChI=1S/C35H56O9/c1-17(36)9-7-11-21(37)12-8-10-18(2)43-33(42-6)24-14-20-13-22(24)29-23-15-25(28(20)29)30(26(23)16-35(4,5)34(40)41)27-19(3)31(38)44-32(27)39/h17-30,33,36-37H,7-16H2,1-6H3,(H,40,41) |
| InChIKey | JONLWPZUXFZWOG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.82 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|