C39H52N6O8S2 — CID 20707465
(2,4,6-trimethylcyclohexyl) 6-isocyano-2-[3-(methanesulfonamido)-4-methoxy-5-[(5-methyl-2-octoxyphenoxy)sulfinylamino]phenyl]-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 20707465) has the molecular formula C39H52N6O8S2 and a molecular weight of 797.01 g/mol. Its IUPAC name is (2,4,6-trimethylcyclohexyl) 6-isocyano-2-[3-(methanesulfonamido)-4-methoxy-5-[(5-methyl-2-octoxyphenoxy)sulfinylamino]phenyl]-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (2,4,6-trimethylcyclohexyl) 6-isocyano-2-[3-(methanesulfonamido)-4-methoxy-5-[(5-methyl-2-octoxyphenoxy)sulfinylamino]phenyl]-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 20707465 |
| Molecular Formula | C39H52N6O8S2 |
| Molecular Weight | 797.01 g/mol |
| Exact Mass | 796.33 |
| IUPAC Name | (2,4,6-trimethylcyclohexyl) 6-isocyano-2-[3-(methanesulfonamido)-4-methoxy-5-[(5-methyl-2-octoxyphenoxy)sulfinylamino]phenyl]-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1cn2[nH]c(-c3cc(NS(=O)Oc4cc(C)ccc4OCCCCCCCC)c(OC)c(NS(C)(=O)=O)c3)nc2c1C(=O)OC1C(C)CC(C)CC1C |
| InChI | InChI=1S/C39H52N6O8S2/c1-9-10-11-12-13-14-17-51-32-16-15-24(2)20-33(32)53-54(47)43-29-21-28(22-30(36(29)50-7)44-55(8,48)49)37-41-38-34(31(40-6)23-45(38)42-37)39(46)52-35-26(4)18-25(3)19-27(35)5/h15-16,20-23,25-27,35,43-44H,9-14,17-19H2,1-5,7-8H3,(H,41,42) |
| InChIKey | LBVZIZHIABJZGM-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 166.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.01 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|