C35H42N6O9S2 — CID 20707482
(2,6-dimethylcyclohexyl) 2-[3-[[5-tert-butyl-2-[2-(methanesulfonamido)-2-oxoethoxy]phenoxy]sulfinylamino]-4-methoxyphenyl]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 20707482) has the molecular formula C35H42N6O9S2 and a molecular weight of 754.89 g/mol. Its IUPAC name is (2,6-dimethylcyclohexyl) 2-[3-[[5-tert-butyl-2-[2-(methanesulfonamido)-2-oxoethoxy]phenoxy]sulfinylamino]-4-methoxyphenyl]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (2,6-dimethylcyclohexyl) 2-[3-[[5-tert-butyl-2-[2-(methanesulfonamido)-2-oxoethoxy]phenoxy]sulfinylamino]-4-methoxyphenyl]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 20707482 |
| Molecular Formula | C35H42N6O9S2 |
| Molecular Weight | 754.89 g/mol |
| Exact Mass | 754.25 |
| IUPAC Name | (2,6-dimethylcyclohexyl) 2-[3-[[5-tert-butyl-2-[2-(methanesulfonamido)-2-oxoethoxy]phenoxy]sulfinylamino]-4-methoxyphenyl]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1cn2[nH]c(-c3ccc(OC)c(NS(=O)Oc4cc(C(C)(C)C)ccc4OCC(=O)NS(C)(=O)=O)c3)nc2c1C(=O)OC1C(C)CCCC1C |
| InChI | InChI=1S/C35H42N6O9S2/c1-20-10-9-11-21(2)31(20)49-34(43)30-25(36-6)18-41-33(30)37-32(38-41)22-12-14-26(47-7)24(16-22)39-51(44)50-28-17-23(35(3,4)5)13-15-27(28)48-19-29(42)40-52(8,45)46/h12-18,20-21,31,39H,9-11,19H2,1-5,7-8H3,(H,37,38)(H,40,42) |
| InChIKey | RMAFAGPUNHBGLJ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 183.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.89 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|