C33H35Cl2N5O5 — CID 20707505
4-[2-[2-chloro-5-[5-chloro-6-isocyano-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]anilino]-4-methylphenoxy]butanoic acid (PubChem CID 20707505) has the molecular formula C33H35Cl2N5O5 and a molecular weight of 652.58 g/mol. Its IUPAC name is 4-[2-[2-chloro-5-[5-chloro-6-isocyano-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]anilino]-4-methylphenoxy]butanoic acid.
| Compound Name | 4-[2-[2-chloro-5-[5-chloro-6-isocyano-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]anilino]-4-methylphenoxy]butanoic acid |
|---|---|
| PubChem CID | 20707505 |
| Molecular Formula | C33H35Cl2N5O5 |
| Molecular Weight | 652.58 g/mol |
| Exact Mass | 651.20 |
| IUPAC Name | 4-[2-[2-chloro-5-[5-chloro-6-isocyano-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]anilino]-4-methylphenoxy]butanoic acid |
| SMILES | [C-]#[N+]c1c(C(=O)OC2C(C)CC(C)CC2C)c2nc(-c3ccc(Cl)c(Nc4cc(C)ccc4OCCCC(=O)O)c3)[nH]n2c1Cl |
| InChI | InChI=1S/C33H35Cl2N5O5/c1-17-8-11-25(44-12-6-7-26(41)42)24(15-17)37-23-16-21(9-10-22(23)34)31-38-32-27(28(36-5)30(35)40(32)39-31)33(43)45-29-19(3)13-18(2)14-20(29)4/h8-11,15-16,18-20,29,37H,6-7,12-14H2,1-4H3,(H,38,39)(H,41,42) |
| InChIKey | GQYYHHDLGMLIES-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.58 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|