C23H22N2O4S2 — CID 20707826
3-pyridin-3-ylpropyl 2-(thiophene-2-carbonylsulfinyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate (PubChem CID 20707826) has the molecular formula C23H22N2O4S2 and a molecular weight of 454.57 g/mol. Its IUPAC name is 3-pyridin-3-ylpropyl 2-(thiophene-2-carbonylsulfinyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate.
| Compound Name | 3-pyridin-3-ylpropyl 2-(thiophene-2-carbonylsulfinyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 20707826 |
| Molecular Formula | C23H22N2O4S2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 3-pyridin-3-ylpropyl 2-(thiophene-2-carbonylsulfinyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate |
| SMILES | O=C(OCCCc1cccnc1)C1Cc2ccccc2CN1S(=O)C(=O)c1cccs1 |
| InChI | InChI=1S/C23H22N2O4S2/c26-22(29-12-4-7-17-6-3-11-24-15-17)20-14-18-8-1-2-9-19(18)16-25(20)31(28)23(27)21-10-5-13-30-21/h1-3,5-6,8-11,13,15,20H,4,7,12,14,16H2 |
| InChIKey | NYGQKTPEFDRYFS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|