About 2-[2-methyl-2,3-bis[2-(2-methylprop-2-enoyloxy)ethoxy]propoxy]ethyl 2-methylprop-2-enoate
2-[2-methyl-2,3-bis[2-(2-methylprop-2-enoyloxy)ethoxy]propoxy]ethyl 2-methylprop-2-enoate (PubChem CID 20708515) has the molecular formula C22H34O9
and a molecular weight of 442.51 g/mol. Its IUPAC name is 2-[2-methyl-2,3-bis[2-(2-methylprop-2-enoyloxy)ethoxy]propoxy]ethyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 2-[2-methyl-2,3-bis[2-(2-methylprop-2-enoyloxy)ethoxy]propoxy]ethyl 2-methylprop-2-enoate |
| PubChem CID | 20708515 |
| Molecular Formula | C22H34O9 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 2-[2-methyl-2,3-bis[2-(2-methylprop-2-enoyloxy)ethoxy]propoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCC(C)(COCCOC(=O)C(=C)C)OCCOC(=O)C(=C)C |
| InChI | InChI=1S/C22H34O9/c1-16(2)19(23)28-10-8-26-14-22(7,31-13-12-30-21(25)18(5)6)15-27-9-11-29-20(24)17(3)4/h1,3,5,8-15H2,2,4,6-7H3 |
| InChIKey | DCIUGZPDJPOQFR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-methyl-2,3-bis[2-(2-methylprop-2-enoyloxy)ethoxy]propoxy]ethyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-methyl-2,3-bis[2-(2-methylprop-2-enoyloxy)ethoxy]propoxy]ethyl 2-methylprop-2-enoate?
The IUPAC name of 2-[2-methyl-2,3-bis[2-(2-methylprop-2-enoyloxy)ethoxy]propoxy]ethyl 2-methylprop-2-enoate (CID 20708515) is 2-[2-methyl-2,3-bis[2-(2-methylprop-2-enoyloxy)ethoxy]propoxy]ethyl 2-methylprop-2-enoate.
What is the SMILES notation for 2-[2-methyl-2,3-bis[2-(2-methylprop-2-enoyloxy)ethoxy]propoxy]ethyl 2-methylprop-2-enoate?
The canonical SMILES for 2-[2-methyl-2,3-bis[2-(2-methylprop-2-enoyloxy)ethoxy]propoxy]ethyl 2-methylprop-2-enoate is C=C(C)C(=O)OCCOCC(C)(COCCOC(=O)C(=C)C)OCCOC(=O)C(=C)C.
What is the InChIKey of 2-[2-methyl-2,3-bis[2-(2-methylprop-2-enoyloxy)ethoxy]propoxy]ethyl 2-methylprop-2-enoate?
The InChIKey is DCIUGZPDJPOQFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H34O9/c1-16(2)19(23)28-10-8-26-14-22(7,31-13-12-30-21(25)18(5)6)15-27-9-11-29-20(24)17(3)4/h1,3,5,8-15H2,2,4,6-7H3.
What are the key properties of 2-[2-methyl-2,3-bis[2-(2-methylprop-2-enoyloxy)ethoxy]propoxy]ethyl 2-methylprop-2-enoate?
2-[2-methyl-2,3-bis[2-(2-methylprop-2-enoyloxy)ethoxy]propoxy]ethyl 2-methylprop-2-enoate has a molecular weight of 442.51 g/mol, XLogP of 2.15, 17 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-methyl-2,3-bis[2-(2-methylprop-2-enoyloxy)ethoxy]propoxy]ethyl 2-methylprop-2-enoate is sourced from PubChem (CID 20708515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).