About 5-methoxy-2-propyl-3a,7a-dihydro-1H-indole
5-methoxy-2-propyl-3a,7a-dihydro-1H-indole (PubChem CID 20708620) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is 5-methoxy-2-propyl-3a,7a-dihydro-1H-indole.
Molecular Properties
| Compound Name | 5-methoxy-2-propyl-3a,7a-dihydro-1H-indole |
| PubChem CID | 20708620 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 5-methoxy-2-propyl-3a,7a-dihydro-1H-indole |
| SMILES | CCCC1=CC2C=C(OC)C=CC2N1 |
| InChI | InChI=1S/C12H17NO/c1-3-4-10-7-9-8-11(14-2)5-6-12(9)13-10/h5-9,12-13H,3-4H2,1-2H3 |
| InChIKey | ZNIPNYKPNZHWPM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methoxy-2-propyl-3a,7a-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2-propyl-3a,7a-dihydro-1H-indole?
The IUPAC name of 5-methoxy-2-propyl-3a,7a-dihydro-1H-indole (CID 20708620) is 5-methoxy-2-propyl-3a,7a-dihydro-1H-indole.
What is the SMILES notation for 5-methoxy-2-propyl-3a,7a-dihydro-1H-indole?
The canonical SMILES for 5-methoxy-2-propyl-3a,7a-dihydro-1H-indole is CCCC1=CC2C=C(OC)C=CC2N1.
What is the InChIKey of 5-methoxy-2-propyl-3a,7a-dihydro-1H-indole?
The InChIKey is ZNIPNYKPNZHWPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c1-3-4-10-7-9-8-11(14-2)5-6-12(9)13-10/h5-9,12-13H,3-4H2,1-2H3.
What are the key properties of 5-methoxy-2-propyl-3a,7a-dihydro-1H-indole?
5-methoxy-2-propyl-3a,7a-dihydro-1H-indole has a molecular weight of 191.27 g/mol, XLogP of 2.36, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2-propyl-3a,7a-dihydro-1H-indole is sourced from PubChem (CID 20708620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).