C57H50N2O6 — CID 20709029
[4-[2-[4-[3-(N-[4-[4-(N-(3-methoxyphenyl)anilino)phenyl]phenyl]anilino)phenoxy]carbonyloxy-3-methylphenyl]propan-2-yl]-2-methylphenyl] acetate (PubChem CID 20709029) has the molecular formula C57H50N2O6 and a molecular weight of 859.04 g/mol. Its IUPAC name is [4-[2-[4-[3-(N-[4-[4-(N-(3-methoxyphenyl)anilino)phenyl]phenyl]anilino)phenoxy]carbonyloxy-3-methylphenyl]propan-2-yl]-2-methylphenyl] acetate.
| Compound Name | [4-[2-[4-[3-(N-[4-[4-(N-(3-methoxyphenyl)anilino)phenyl]phenyl]anilino)phenoxy]carbonyloxy-3-methylphenyl]propan-2-yl]-2-methylphenyl] acetate |
|---|---|
| PubChem CID | 20709029 |
| Molecular Formula | C57H50N2O6 |
| Molecular Weight | 859.04 g/mol |
| Exact Mass | 858.37 |
| IUPAC Name | [4-[2-[4-[3-(N-[4-[4-(N-(3-methoxyphenyl)anilino)phenyl]phenyl]anilino)phenoxy]carbonyloxy-3-methylphenyl]propan-2-yl]-2-methylphenyl] acetate |
| SMILES | COc1cccc(N(c2ccccc2)c2ccc(-c3ccc(N(c4ccccc4)c4cccc(OC(=O)Oc5ccc(C(C)(C)c6ccc(OC(C)=O)c(C)c6)cc5C)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C57H50N2O6/c1-39-35-44(27-33-54(39)63-41(3)60)57(4,5)45-28-34-55(40(2)36-45)65-56(61)64-53-22-14-20-51(38-53)59(47-17-11-8-12-18-47)49-31-25-43(26-32-49)42-23-29-48(30-24-42)58(46-15-9-7-10-16-46)50-19-13-21-52(37-50)62-6/h7-38H,1-6H3 |
| InChIKey | RPCSDPAKMKTNFL-UHFFFAOYSA-N |
| XLogP | 14.75 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.04 |
| LogP ≤ 5 | 14.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|