About 4-(3,4-difluorophenyl)-1-(1-phenylethyl)-1,3-diazinan-2-one
4-(3,4-difluorophenyl)-1-(1-phenylethyl)-1,3-diazinan-2-one (PubChem CID 20709282) has the molecular formula C18H18F2N2O
and a molecular weight of 316.35 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-1-(1-phenylethyl)-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | 4-(3,4-difluorophenyl)-1-(1-phenylethyl)-1,3-diazinan-2-one |
| PubChem CID | 20709282 |
| Molecular Formula | C18H18F2N2O |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 4-(3,4-difluorophenyl)-1-(1-phenylethyl)-1,3-diazinan-2-one |
| SMILES | CC(c1ccccc1)N1CCC(c2ccc(F)c(F)c2)NC1=O |
| InChI | InChI=1S/C18H18F2N2O/c1-12(13-5-3-2-4-6-13)22-10-9-17(21-18(22)23)14-7-8-15(19)16(20)11-14/h2-8,11-12,17H,9-10H2,1H3,(H,21,23) |
| InChIKey | AMZACZHEWJNXSW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(3,4-difluorophenyl)-1-(1-phenylethyl)-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-difluorophenyl)-1-(1-phenylethyl)-1,3-diazinan-2-one?
The IUPAC name of 4-(3,4-difluorophenyl)-1-(1-phenylethyl)-1,3-diazinan-2-one (CID 20709282) is 4-(3,4-difluorophenyl)-1-(1-phenylethyl)-1,3-diazinan-2-one.
What is the SMILES notation for 4-(3,4-difluorophenyl)-1-(1-phenylethyl)-1,3-diazinan-2-one?
The canonical SMILES for 4-(3,4-difluorophenyl)-1-(1-phenylethyl)-1,3-diazinan-2-one is CC(c1ccccc1)N1CCC(c2ccc(F)c(F)c2)NC1=O.
What is the InChIKey of 4-(3,4-difluorophenyl)-1-(1-phenylethyl)-1,3-diazinan-2-one?
The InChIKey is AMZACZHEWJNXSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18F2N2O/c1-12(13-5-3-2-4-6-13)22-10-9-17(21-18(22)23)14-7-8-15(19)16(20)11-14/h2-8,11-12,17H,9-10H2,1H3,(H,21,23).
What are the key properties of 4-(3,4-difluorophenyl)-1-(1-phenylethyl)-1,3-diazinan-2-one?
4-(3,4-difluorophenyl)-1-(1-phenylethyl)-1,3-diazinan-2-one has a molecular weight of 316.35 g/mol, XLogP of 4.18, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-difluorophenyl)-1-(1-phenylethyl)-1,3-diazinan-2-one is sourced from PubChem (CID 20709282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).