C9H18NbO4-2 — CID 20709822
carbanide;2-ethyl-3,4-dimethoxy-2,3,4,5-tetrahydrofuran-5-ide;oxoniobium (PubChem CID 20709822) has the molecular formula C9H18NbO4-2 and a molecular weight of 283.15 g/mol. Its IUPAC name is carbanide;2-ethyl-3,4-dimethoxy-2,3,4,5-tetrahydrofuran-5-ide;oxoniobium.
| Compound Name | carbanide;2-ethyl-3,4-dimethoxy-2,3,4,5-tetrahydrofuran-5-ide;oxoniobium |
|---|---|
| PubChem CID | 20709822 |
| Molecular Formula | C9H18NbO4-2 |
| Molecular Weight | 283.15 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | carbanide;2-ethyl-3,4-dimethoxy-2,3,4,5-tetrahydrofuran-5-ide;oxoniobium |
| SMILES | CCC1O[CH-]C(OC)C1OC.O=[Nb].[CH3-] |
| InChI | InChI=1S/C8H15O3.CH3.Nb.O/c1-4-6-8(10-3)7(9-2)5-11-6;;;/h5-8H,4H2,1-3H3;1H3;;/q2*-1;; |
| InChIKey | KTJKIGRCVYAPPN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.15 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|