C8H16NbO2 — CID 20709824
carbanide;2-ethyl-3-methoxy-2,3,4,5-tetrahydrofuran-5-ide;niobium(2+) (PubChem CID 20709824) has the molecular formula C8H16NbO2 and a molecular weight of 237.12 g/mol. Its IUPAC name is carbanide;2-ethyl-3-methoxy-2,3,4,5-tetrahydrofuran-5-ide;niobium(2+).
| Compound Name | carbanide;2-ethyl-3-methoxy-2,3,4,5-tetrahydrofuran-5-ide;niobium(2+) |
|---|---|
| PubChem CID | 20709824 |
| Molecular Formula | C8H16NbO2 |
| Molecular Weight | 237.12 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | carbanide;2-ethyl-3-methoxy-2,3,4,5-tetrahydrofuran-5-ide;niobium(2+) |
| SMILES | CCC1O[CH-]CC1OC.[CH3-].[Nb+2] |
| InChI | InChI=1S/C7H13O2.CH3.Nb/c1-3-6-7(8-2)4-5-9-6;;/h5-7H,3-4H2,1-2H3;1H3;/q2*-1;+2 |
| InChIKey | SLNYSDNMNPXXER-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.12 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|