C72H48Si — CID 20710018
3,3',7,7'-tetrakis(4-phenylphenyl)-5,5'-spirobi[benzo[b][1]benzosilole] (PubChem CID 20710018) has the molecular formula C72H48Si and a molecular weight of 941.26 g/mol. Its IUPAC name is 3,3',7,7'-tetrakis(4-phenylphenyl)-5,5'-spirobi[benzo[b][1]benzosilole].
| Compound Name | 3,3',7,7'-tetrakis(4-phenylphenyl)-5,5'-spirobi[benzo[b][1]benzosilole] |
|---|---|
| PubChem CID | 20710018 |
| Molecular Formula | C72H48Si |
| Molecular Weight | 941.26 g/mol |
| Exact Mass | 940.35 |
| IUPAC Name | 3,3',7,7'-tetrakis(4-phenylphenyl)-5,5'-spirobi[benzo[b][1]benzosilole] |
| SMILES | c1ccc(-c2ccc(-c3ccc4c(c3)[Si]3(c5cc(-c6ccc(-c7ccccc7)cc6)ccc5-4)c4cc(-c5ccc(-c6ccccc6)cc5)ccc4-c4ccc(-c5ccc(-c6ccccc6)cc5)cc43)cc2)cc1 |
| InChI | InChI=1S/C72H48Si/c1-5-13-49(14-6-1)53-21-29-57(30-22-53)61-37-41-65-66-42-38-62(58-31-23-54(24-32-58)50-15-7-2-8-16-50)46-70(66)73(69(65)45-61)71-47-63(59-33-25-55(26-34-59)51-17-9-3-10-18-51)39-43-67(71)68-44-40-64(48-72(68)73)60-35-27-56(28-36-60)52-19-11-4-12-20-52/h1-48H |
| InChIKey | LMRBINCQVQCMOG-UHFFFAOYSA-N |
| XLogP | 16.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 941.26 |
| LogP ≤ 5 | 16.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|