C48H38N2O4 — CID 20710079
3-N,3-N,9-N,9-N-tetrakis(4-methoxyphenyl)perylene-3,9-diamine (PubChem CID 20710079) has the molecular formula C48H38N2O4 and a molecular weight of 706.84 g/mol. Its IUPAC name is 3-N,3-N,9-N,9-N-tetrakis(4-methoxyphenyl)perylene-3,9-diamine.
| Compound Name | 3-N,3-N,9-N,9-N-tetrakis(4-methoxyphenyl)perylene-3,9-diamine |
|---|---|
| PubChem CID | 20710079 |
| Molecular Formula | C48H38N2O4 |
| Molecular Weight | 706.84 g/mol |
| Exact Mass | 706.28 |
| IUPAC Name | 3-N,3-N,9-N,9-N-tetrakis(4-methoxyphenyl)perylene-3,9-diamine |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccc3c4cccc5c(N(c6ccc(OC)cc6)c6ccc(OC)cc6)ccc(c6cccc2c63)c54)cc1 |
| InChI | InChI=1S/C48H38N2O4/c1-51-35-19-11-31(12-20-35)49(32-13-21-36(52-2)22-14-32)45-29-27-41-40-8-6-10-44-46(30-28-42(48(40)44)39-7-5-9-43(45)47(39)41)50(33-15-23-37(53-3)24-16-33)34-17-25-38(54-4)26-18-34/h5-30H,1-4H3 |
| InChIKey | HQKKKQGOXQDYAK-UHFFFAOYSA-N |
| XLogP | 12.71 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.84 |
| LogP ≤ 5 | 12.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|