About 5,10-dimethylidenepyrazino[2,3-g]quinoxaline
5,10-dimethylidenepyrazino[2,3-g]quinoxaline (PubChem CID 20710137) has the molecular formula C12H8N4
and a molecular weight of 208.22 g/mol. Its IUPAC name is 5,10-dimethylidenepyrazino[2,3-g]quinoxaline.
Molecular Properties
| Compound Name | 5,10-dimethylidenepyrazino[2,3-g]quinoxaline |
| PubChem CID | 20710137 |
| Molecular Formula | C12H8N4 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 5,10-dimethylidenepyrazino[2,3-g]quinoxaline |
| SMILES | C=c1c2nccnc2c(=C)c2nccnc12 |
| InChI | InChI=1S/C12H8N4/c1-7-9-11(15-5-3-13-9)8(2)12-10(7)14-4-6-16-12/h3-6H,1-2H2 |
| InChIKey | RZSQOQNPPRRXDK-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 5,10-dimethylidenepyrazino[2,3-g]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,10-dimethylidenepyrazino[2,3-g]quinoxaline?
The IUPAC name of 5,10-dimethylidenepyrazino[2,3-g]quinoxaline (CID 20710137) is 5,10-dimethylidenepyrazino[2,3-g]quinoxaline.
What is the SMILES notation for 5,10-dimethylidenepyrazino[2,3-g]quinoxaline?
The canonical SMILES for 5,10-dimethylidenepyrazino[2,3-g]quinoxaline is C=c1c2nccnc2c(=C)c2nccnc12.
What is the InChIKey of 5,10-dimethylidenepyrazino[2,3-g]quinoxaline?
The InChIKey is RZSQOQNPPRRXDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N4/c1-7-9-11(15-5-3-13-9)8(2)12-10(7)14-4-6-16-12/h3-6H,1-2H2.
What are the key properties of 5,10-dimethylidenepyrazino[2,3-g]quinoxaline?
5,10-dimethylidenepyrazino[2,3-g]quinoxaline has a molecular weight of 208.22 g/mol, XLogP of 0.39, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,10-dimethylidenepyrazino[2,3-g]quinoxaline is sourced from PubChem (CID 20710137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).