C12H17NO2 — CID 20710885
2-(4-methoxyphenyl)-N,N-dimethylpropanamide (PubChem CID 20710885) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N,N-dimethylpropanamide.
| Compound Name | 2-(4-methoxyphenyl)-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 20710885 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2-(4-methoxyphenyl)-N,N-dimethylpropanamide |
| SMILES | COc1ccc(C(C)C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C12H17NO2/c1-9(12(14)13(2)3)10-5-7-11(15-4)8-6-10/h5-9H,1-4H3 |
| InChIKey | XZCIQIWNRFWIQM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |