C14H28O2 — CID 20711558
6-tert-butyl-4-methoxy-2,3,3,4-tetramethyloxane (PubChem CID 20711558) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is 6-tert-butyl-4-methoxy-2,3,3,4-tetramethyloxane.
| Compound Name | 6-tert-butyl-4-methoxy-2,3,3,4-tetramethyloxane |
|---|---|
| PubChem CID | 20711558 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 6-tert-butyl-4-methoxy-2,3,3,4-tetramethyloxane |
| SMILES | COC1(C)CC(C(C)(C)C)OC(C)C1(C)C |
| InChI | InChI=1S/C14H28O2/c1-10-13(5,6)14(7,15-8)9-11(16-10)12(2,3)4/h10-11H,9H2,1-8H3 |
| InChIKey | NLOIXMWWMCJFHF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |