About 6-tert-butyl-4-methoxy-2,4-dimethyloxan-3-ol
6-tert-butyl-4-methoxy-2,4-dimethyloxan-3-ol (PubChem CID 20711559) has the molecular formula C12H24O3
and a molecular weight of 216.32 g/mol. Its IUPAC name is 6-tert-butyl-4-methoxy-2,4-dimethyloxan-3-ol.
Molecular Properties
| Compound Name | 6-tert-butyl-4-methoxy-2,4-dimethyloxan-3-ol |
| PubChem CID | 20711559 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | 6-tert-butyl-4-methoxy-2,4-dimethyloxan-3-ol |
| SMILES | COC1(C)CC(C(C)(C)C)OC(C)C1O |
| InChI | InChI=1S/C12H24O3/c1-8-10(13)12(5,14-6)7-9(15-8)11(2,3)4/h8-10,13H,7H2,1-6H3 |
| InChIKey | VZFQWVUAXRJSFP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-tert-butyl-4-methoxy-2,4-dimethyloxan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-4-methoxy-2,4-dimethyloxan-3-ol?
The IUPAC name of 6-tert-butyl-4-methoxy-2,4-dimethyloxan-3-ol (CID 20711559) is 6-tert-butyl-4-methoxy-2,4-dimethyloxan-3-ol.
What is the SMILES notation for 6-tert-butyl-4-methoxy-2,4-dimethyloxan-3-ol?
The canonical SMILES for 6-tert-butyl-4-methoxy-2,4-dimethyloxan-3-ol is COC1(C)CC(C(C)(C)C)OC(C)C1O.
What is the InChIKey of 6-tert-butyl-4-methoxy-2,4-dimethyloxan-3-ol?
The InChIKey is VZFQWVUAXRJSFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O3/c1-8-10(13)12(5,14-6)7-9(15-8)11(2,3)4/h8-10,13H,7H2,1-6H3.
What are the key properties of 6-tert-butyl-4-methoxy-2,4-dimethyloxan-3-ol?
6-tert-butyl-4-methoxy-2,4-dimethyloxan-3-ol has a molecular weight of 216.32 g/mol, XLogP of 1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-4-methoxy-2,4-dimethyloxan-3-ol is sourced from PubChem (CID 20711559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).