About methyl 2-(1,4-dioxaspiro[4.5]decan-8-yl)acetate
methyl 2-(1,4-dioxaspiro[4.5]decan-8-yl)acetate (PubChem CID 20711792) has the molecular formula C11H18O4
and a molecular weight of 214.26 g/mol. Its IUPAC name is methyl 2-(1,4-dioxaspiro[4.5]decan-8-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(1,4-dioxaspiro[4.5]decan-8-yl)acetate |
| PubChem CID | 20711792 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | methyl 2-(1,4-dioxaspiro[4.5]decan-8-yl)acetate |
| SMILES | COC(=O)CC1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C11H18O4/c1-13-10(12)8-9-2-4-11(5-3-9)14-6-7-15-11/h9H,2-8H2,1H3 |
| InChIKey | WTSFUIKKIMELKH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-(1,4-dioxaspiro[4.5]decan-8-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(1,4-dioxaspiro[4.5]decan-8-yl)acetate?
The IUPAC name of methyl 2-(1,4-dioxaspiro[4.5]decan-8-yl)acetate (CID 20711792) is methyl 2-(1,4-dioxaspiro[4.5]decan-8-yl)acetate.
What is the SMILES notation for methyl 2-(1,4-dioxaspiro[4.5]decan-8-yl)acetate?
The canonical SMILES for methyl 2-(1,4-dioxaspiro[4.5]decan-8-yl)acetate is COC(=O)CC1CCC2(CC1)OCCO2.
What is the InChIKey of methyl 2-(1,4-dioxaspiro[4.5]decan-8-yl)acetate?
The InChIKey is WTSFUIKKIMELKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O4/c1-13-10(12)8-9-2-4-11(5-3-9)14-6-7-15-11/h9H,2-8H2,1H3.
What are the key properties of methyl 2-(1,4-dioxaspiro[4.5]decan-8-yl)acetate?
methyl 2-(1,4-dioxaspiro[4.5]decan-8-yl)acetate has a molecular weight of 214.26 g/mol, XLogP of 1.48, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1,4-dioxaspiro[4.5]decan-8-yl)acetate is sourced from PubChem (CID 20711792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).