C13H12F3N3S2 — CID 20713489
2,3,5-trimethyl-4-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]benzenecarbothioamide (PubChem CID 20713489) has the molecular formula C13H12F3N3S2 and a molecular weight of 331.39 g/mol. Its IUPAC name is 2,3,5-trimethyl-4-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]benzenecarbothioamide.
| Compound Name | 2,3,5-trimethyl-4-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]benzenecarbothioamide |
|---|---|
| PubChem CID | 20713489 |
| Molecular Formula | C13H12F3N3S2 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 2,3,5-trimethyl-4-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]benzenecarbothioamide |
| SMILES | Cc1cc(C(N)=S)c(C)c(C)c1-c1nnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C13H12F3N3S2/c1-5-4-8(10(17)20)6(2)7(3)9(5)11-18-19-12(21-11)13(14,15)16/h4H,1-3H3,(H2,17,20) |
| InChIKey | ISVDMNXUPLNFSG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|