About 2-methyl-2,9-diazaspiro[4.5]decane
2-methyl-2,9-diazaspiro[4.5]decane (PubChem CID 20713879) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is 2-methyl-2,9-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 2-methyl-2,9-diazaspiro[4.5]decane |
| PubChem CID | 20713879 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 2-methyl-2,9-diazaspiro[4.5]decane |
| SMILES | CN1CCC2(CCCNC2)C1 |
| InChI | InChI=1S/C9H18N2/c1-11-6-4-9(8-11)3-2-5-10-7-9/h10H,2-8H2,1H3 |
| InChIKey | BASGGIUQFOKXEP-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-2,9-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2,9-diazaspiro[4.5]decane?
The IUPAC name of 2-methyl-2,9-diazaspiro[4.5]decane (CID 20713879) is 2-methyl-2,9-diazaspiro[4.5]decane.
What is the SMILES notation for 2-methyl-2,9-diazaspiro[4.5]decane?
The canonical SMILES for 2-methyl-2,9-diazaspiro[4.5]decane is CN1CCC2(CCCNC2)C1.
What is the InChIKey of 2-methyl-2,9-diazaspiro[4.5]decane?
The InChIKey is BASGGIUQFOKXEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2/c1-11-6-4-9(8-11)3-2-5-10-7-9/h10H,2-8H2,1H3.
What are the key properties of 2-methyl-2,9-diazaspiro[4.5]decane?
2-methyl-2,9-diazaspiro[4.5]decane has a molecular weight of 154.26 g/mol, XLogP of 0.69, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2,9-diazaspiro[4.5]decane is sourced from PubChem (CID 20713879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).