About 1-[2-[[3-[(2,4-difluorophenyl)methyl]piperidin-1-yl]methyl]-4-methylphenyl]-3-methylurea
1-[2-[[3-[(2,4-difluorophenyl)methyl]piperidin-1-yl]methyl]-4-methylphenyl]-3-methylurea (PubChem CID 20714101) has the molecular formula C22H27F2N3O
and a molecular weight of 387.47 g/mol. Its IUPAC name is 1-[2-[[3-[(2,4-difluorophenyl)methyl]piperidin-1-yl]methyl]-4-methylphenyl]-3-methylurea.
Molecular Properties
| Compound Name | 1-[2-[[3-[(2,4-difluorophenyl)methyl]piperidin-1-yl]methyl]-4-methylphenyl]-3-methylurea |
| PubChem CID | 20714101 |
| Molecular Formula | C22H27F2N3O |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 1-[2-[[3-[(2,4-difluorophenyl)methyl]piperidin-1-yl]methyl]-4-methylphenyl]-3-methylurea |
| SMILES | CNC(=O)Nc1ccc(C)cc1CN1CCCC(Cc2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C22H27F2N3O/c1-15-5-8-21(26-22(28)25-2)18(10-15)14-27-9-3-4-16(13-27)11-17-6-7-19(23)12-20(17)24/h5-8,10,12,16H,3-4,9,11,13-14H2,1-2H3,(H2,25,26,28) |
| InChIKey | IZZVXXYADINXGZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[2-[[3-[(2,4-difluorophenyl)methyl]piperidin-1-yl]methyl]-4-methylphenyl]-3-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[[3-[(2,4-difluorophenyl)methyl]piperidin-1-yl]methyl]-4-methylphenyl]-3-methylurea?
The IUPAC name of 1-[2-[[3-[(2,4-difluorophenyl)methyl]piperidin-1-yl]methyl]-4-methylphenyl]-3-methylurea (CID 20714101) is 1-[2-[[3-[(2,4-difluorophenyl)methyl]piperidin-1-yl]methyl]-4-methylphenyl]-3-methylurea.
What is the SMILES notation for 1-[2-[[3-[(2,4-difluorophenyl)methyl]piperidin-1-yl]methyl]-4-methylphenyl]-3-methylurea?
The canonical SMILES for 1-[2-[[3-[(2,4-difluorophenyl)methyl]piperidin-1-yl]methyl]-4-methylphenyl]-3-methylurea is CNC(=O)Nc1ccc(C)cc1CN1CCCC(Cc2ccc(F)cc2F)C1.
What is the InChIKey of 1-[2-[[3-[(2,4-difluorophenyl)methyl]piperidin-1-yl]methyl]-4-methylphenyl]-3-methylurea?
The InChIKey is IZZVXXYADINXGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27F2N3O/c1-15-5-8-21(26-22(28)25-2)18(10-15)14-27-9-3-4-16(13-27)11-17-6-7-19(23)12-20(17)24/h5-8,10,12,16H,3-4,9,11,13-14H2,1-2H3,(H2,25,26,28).
What are the key properties of 1-[2-[[3-[(2,4-difluorophenyl)methyl]piperidin-1-yl]methyl]-4-methylphenyl]-3-methylurea?
1-[2-[[3-[(2,4-difluorophenyl)methyl]piperidin-1-yl]methyl]-4-methylphenyl]-3-methylurea has a molecular weight of 387.47 g/mol, XLogP of 4.48, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[[3-[(2,4-difluorophenyl)methyl]piperidin-1-yl]methyl]-4-methylphenyl]-3-methylurea is sourced from PubChem (CID 20714101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).