About 2-tert-butyl-2,3,3-trimethylbutanal
2-tert-butyl-2,3,3-trimethylbutanal (PubChem CID 20714170) has the molecular formula C11H22O
and a molecular weight of 170.30 g/mol. Its IUPAC name is 2-tert-butyl-2,3,3-trimethylbutanal.
Molecular Properties
| Compound Name | 2-tert-butyl-2,3,3-trimethylbutanal |
| PubChem CID | 20714170 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | 2-tert-butyl-2,3,3-trimethylbutanal |
| SMILES | CC(C)(C)C(C)(C=O)C(C)(C)C |
| InChI | InChI=1S/C11H22O/c1-9(2,3)11(7,8-12)10(4,5)6/h8H,1-7H3 |
| InChIKey | NWMYUQSWODVDKI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-2,3,3-trimethylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-2,3,3-trimethylbutanal?
The IUPAC name of 2-tert-butyl-2,3,3-trimethylbutanal (CID 20714170) is 2-tert-butyl-2,3,3-trimethylbutanal.
What is the SMILES notation for 2-tert-butyl-2,3,3-trimethylbutanal?
The canonical SMILES for 2-tert-butyl-2,3,3-trimethylbutanal is CC(C)(C)C(C)(C=O)C(C)(C)C.
What is the InChIKey of 2-tert-butyl-2,3,3-trimethylbutanal?
The InChIKey is NWMYUQSWODVDKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O/c1-9(2,3)11(7,8-12)10(4,5)6/h8H,1-7H3.
What are the key properties of 2-tert-butyl-2,3,3-trimethylbutanal?
2-tert-butyl-2,3,3-trimethylbutanal has a molecular weight of 170.30 g/mol, XLogP of 3.28, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-2,3,3-trimethylbutanal is sourced from PubChem (CID 20714170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).