About 2-tert-butyl-2,3,3-trimethylbutanenitrile
2-tert-butyl-2,3,3-trimethylbutanenitrile (PubChem CID 20714171) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is 2-tert-butyl-2,3,3-trimethylbutanenitrile.
Molecular Properties
| Compound Name | 2-tert-butyl-2,3,3-trimethylbutanenitrile |
| PubChem CID | 20714171 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 2-tert-butyl-2,3,3-trimethylbutanenitrile |
| SMILES | CC(C)(C)C(C)(C#N)C(C)(C)C |
| InChI | InChI=1S/C11H21N/c1-9(2,3)11(7,8-12)10(4,5)6/h1-7H3 |
| InChIKey | CNTSYGLBEJXVCC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-tert-butyl-2,3,3-trimethylbutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-2,3,3-trimethylbutanenitrile?
The IUPAC name of 2-tert-butyl-2,3,3-trimethylbutanenitrile (CID 20714171) is 2-tert-butyl-2,3,3-trimethylbutanenitrile.
What is the SMILES notation for 2-tert-butyl-2,3,3-trimethylbutanenitrile?
The canonical SMILES for 2-tert-butyl-2,3,3-trimethylbutanenitrile is CC(C)(C)C(C)(C#N)C(C)(C)C.
What is the InChIKey of 2-tert-butyl-2,3,3-trimethylbutanenitrile?
The InChIKey is CNTSYGLBEJXVCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N/c1-9(2,3)11(7,8-12)10(4,5)6/h1-7H3.
What are the key properties of 2-tert-butyl-2,3,3-trimethylbutanenitrile?
2-tert-butyl-2,3,3-trimethylbutanenitrile has a molecular weight of 167.30 g/mol, XLogP of 3.61, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-2,3,3-trimethylbutanenitrile is sourced from PubChem (CID 20714171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).