C13H27F — CID 20714203
3-fluoro-2,2,3,4,4,5,5-heptamethylhexane (PubChem CID 20714203) has the molecular formula C13H27F and a molecular weight of 202.36 g/mol. Its IUPAC name is 3-fluoro-2,2,3,4,4,5,5-heptamethylhexane.
| Compound Name | 3-fluoro-2,2,3,4,4,5,5-heptamethylhexane |
|---|---|
| PubChem CID | 20714203 |
| Molecular Formula | C13H27F |
| Molecular Weight | 202.36 g/mol |
| Exact Mass | 202.21 |
| IUPAC Name | 3-fluoro-2,2,3,4,4,5,5-heptamethylhexane |
| SMILES | CC(C)(C)C(C)(C)C(C)(F)C(C)(C)C |
| InChI | InChI=1S/C13H27F/c1-10(2,3)12(7,8)13(9,14)11(4,5)6/h1-9H3 |
| InChIKey | DQNWESOQNFHOCX-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.36 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |