About 4-chloro-3-ethylaniline
4-chloro-3-ethylaniline (PubChem CID 20714347) has the molecular formula C8H10ClN
and a molecular weight of 155.63 g/mol. Its IUPAC name is 4-chloro-3-ethylaniline.
Molecular Properties
| Compound Name | 4-chloro-3-ethylaniline |
| PubChem CID | 20714347 |
| Molecular Formula | C8H10ClN |
| Molecular Weight | 155.63 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | 4-chloro-3-ethylaniline |
| SMILES | CCc1cc(N)ccc1Cl |
| InChI | InChI=1S/C8H10ClN/c1-2-6-5-7(10)3-4-8(6)9/h3-5H,2,10H2,1H3 |
| InChIKey | RFPXQROYDXYJFA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.63 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3-ethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-ethylaniline?
The IUPAC name of 4-chloro-3-ethylaniline (CID 20714347) is 4-chloro-3-ethylaniline.
What is the SMILES notation for 4-chloro-3-ethylaniline?
The canonical SMILES for 4-chloro-3-ethylaniline is CCc1cc(N)ccc1Cl.
What is the InChIKey of 4-chloro-3-ethylaniline?
The InChIKey is RFPXQROYDXYJFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClN/c1-2-6-5-7(10)3-4-8(6)9/h3-5H,2,10H2,1H3.
What are the key properties of 4-chloro-3-ethylaniline?
4-chloro-3-ethylaniline has a molecular weight of 155.63 g/mol, XLogP of 2.48, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-ethylaniline is sourced from PubChem (CID 20714347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).