C19H28O5 — CID 20714519
[3-(2-bicyclo[2.2.1]hept-5-enyl)-3-oxopropyl] 2-(2,5,5-trimethyl-1,3-dioxan-2-yl)acetate (PubChem CID 20714519) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is [3-(2-bicyclo[2.2.1]hept-5-enyl)-3-oxopropyl] 2-(2,5,5-trimethyl-1,3-dioxan-2-yl)acetate.
| Compound Name | [3-(2-bicyclo[2.2.1]hept-5-enyl)-3-oxopropyl] 2-(2,5,5-trimethyl-1,3-dioxan-2-yl)acetate |
|---|---|
| PubChem CID | 20714519 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | [3-(2-bicyclo[2.2.1]hept-5-enyl)-3-oxopropyl] 2-(2,5,5-trimethyl-1,3-dioxan-2-yl)acetate |
| SMILES | CC1(C)COC(C)(CC(=O)OCCC(=O)C2CC3C=CC2C3)OC1 |
| InChI | InChI=1S/C19H28O5/c1-18(2)11-23-19(3,24-12-18)10-17(21)22-7-6-16(20)15-9-13-4-5-14(15)8-13/h4-5,13-15H,6-12H2,1-3H3 |
| InChIKey | FJWOHGYCDPNAJN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|