C18H16ClFN2O5 — CID 20714661
(2S)-2-[(2-chloro-6-fluorobenzoyl)amino]-3-[(3-methoxybenzoyl)amino]propanoic acid (PubChem CID 20714661) has the molecular formula C18H16ClFN2O5 and a molecular weight of 394.79 g/mol. Its IUPAC name is (2S)-2-[(2-chloro-6-fluorobenzoyl)amino]-3-[(3-methoxybenzoyl)amino]propanoic acid.
| Compound Name | (2S)-2-[(2-chloro-6-fluorobenzoyl)amino]-3-[(3-methoxybenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 20714661 |
| Molecular Formula | C18H16ClFN2O5 |
| Molecular Weight | 394.79 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | (2S)-2-[(2-chloro-6-fluorobenzoyl)amino]-3-[(3-methoxybenzoyl)amino]propanoic acid |
| SMILES | COc1cccc(C(=O)NC[C@H](NC(=O)c2c(F)cccc2Cl)C(=O)O)c1 |
| InChI | InChI=1S/C18H16ClFN2O5/c1-27-11-5-2-4-10(8-11)16(23)21-9-14(18(25)26)22-17(24)15-12(19)6-3-7-13(15)20/h2-8,14H,9H2,1H3,(H,21,23)(H,22,24)(H,25,26)/t14-/m0/s1 |
| InChIKey | WNJKJKWQYKLHAP-AWEZNQCLSA-N |
| XLogP | 2.10 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.79 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |