C10H23NO — CID 20714780
3-ethyl-5-methoxy-N,N-dimethylpentan-1-amine (PubChem CID 20714780) has the molecular formula C10H23NO and a molecular weight of 173.30 g/mol. Its IUPAC name is 3-ethyl-5-methoxy-N,N-dimethylpentan-1-amine.
| Compound Name | 3-ethyl-5-methoxy-N,N-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 20714780 |
| Molecular Formula | C10H23NO |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.18 |
| IUPAC Name | 3-ethyl-5-methoxy-N,N-dimethylpentan-1-amine |
| SMILES | CCC(CCOC)CCN(C)C |
| InChI | InChI=1S/C10H23NO/c1-5-10(7-9-12-4)6-8-11(2)3/h10H,5-9H2,1-4H3 |
| InChIKey | UOVMFOFOJBOMLO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |