C56H7- — CID 20714986
15-undeca-2,3,4,5,6,7,8,9,10-nonaen-2-ylpentatetraconta-1,2,3,4,5,6,7,8,9,10,11,12,13,14-tetradecaen-16,18,20,22,24,26,28,30,32,34,36,38,40,42,44-pentadecayne (PubChem CID 20714986) has the molecular formula C56H7- and a molecular weight of 679.67 g/mol. Its IUPAC name is 15-undeca-2,3,4,5,6,7,8,9,10-nonaen-2-ylpentatetraconta-1,2,3,4,5,6,7,8,9,10,11,12,13,14-tetradecaen-16,18,20,22,24,26,28,30,32,34,36,38,40,42,44-pentadecayne.
| Compound Name | 15-undeca-2,3,4,5,6,7,8,9,10-nonaen-2-ylpentatetraconta-1,2,3,4,5,6,7,8,9,10,11,12,13,14-tetradecaen-16,18,20,22,24,26,28,30,32,34,36,38,40,42,44-pentadecayne |
|---|---|
| PubChem CID | 20714986 |
| Molecular Formula | C56H7- |
| Molecular Weight | 679.67 g/mol |
| Exact Mass | 679.06 |
| IUPAC Name | 15-undeca-2,3,4,5,6,7,8,9,10-nonaen-2-ylpentatetraconta-1,2,3,4,5,6,7,8,9,10,11,12,13,14-tetradecaen-16,18,20,22,24,26,28,30,32,34,36,38,40,42,44-pentadecayne |
| SMILES | [C-]#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC(=C=C=C=C=C=C=C=C=C=C=C=C=C=C)C(C)=C=C=C=C=C=C=C=C=C |
| InChI | InChI=1S/C56H7/c1-5-8-11-14-17-19-21-23-24-25-26-27-28-29-30-31-32-33-34-35-36-37-38-40-42-45-48-51-54-56(55(4)52-49-46-43-16-13-10-7-3)53-50-47-44-41-39-22-20-18-15-12-9-6-2/h2-3H2,4H3/q-1 |
| InChIKey | ZUQAIYOCDHLDOV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.67 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|