C7H11N3O2 — CID 20715109
methyl 4-amino-1,3-dimethylpyrazole-5-carboxylate (PubChem CID 20715109) has the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. Its IUPAC name is methyl 4-amino-1,3-dimethylpyrazole-5-carboxylate.
| Compound Name | methyl 4-amino-1,3-dimethylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 20715109 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | methyl 4-amino-1,3-dimethylpyrazole-5-carboxylate |
| SMILES | COC(=O)c1c(N)c(C)nn1C |
| InChI | InChI=1S/C7H11N3O2/c1-4-5(8)6(7(11)12-3)10(2)9-4/h8H2,1-3H3 |
| InChIKey | PUTMXTILUKFDHK-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |