methyl 4-amino-1,3-dimethylpyrazole-5-carboxylate

C7H11N3O2 — CID 20715109

IUPACmethyl 4-amino-1,3-dimethylpyrazole-5-carboxylate
SMILESCOC(=O)c1c(N)c(C)nn1C
InChIInChI=1S/C7H11N3O2/c1-4-5(8)6(7(11)12-3)10(2)9-4/h8H2,1-3H3
InChIKeyPUTMXTILUKFDHK-UHFFFAOYSA-N
MW169.18 g/mol
LogP0.10
Rot. Bonds1

About methyl 4-amino-1,3-dimethylpyrazole-5-carboxylate

methyl 4-amino-1,3-dimethylpyrazole-5-carboxylate (PubChem CID 20715109) has the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. Its IUPAC name is methyl 4-amino-1,3-dimethylpyrazole-5-carboxylate.

Molecular Properties

Compound Namemethyl 4-amino-1,3-dimethylpyrazole-5-carboxylate
PubChem CID20715109
Molecular FormulaC7H11N3O2
Molecular Weight169.18 g/mol
Exact Mass169.09
IUPAC Namemethyl 4-amino-1,3-dimethylpyrazole-5-carboxylate
SMILESCOC(=O)c1c(N)c(C)nn1C
InChIInChI=1S/C7H11N3O2/c1-4-5(8)6(7(11)12-3)10(2)9-4/h8H2,1-3H3
InChIKeyPUTMXTILUKFDHK-UHFFFAOYSA-N
XLogP0.10
TPSA70.14 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500169.18
LogP ≤ 50.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 4-amino-1,3-dimethylpyrazole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-amino-1,3-dimethylpyrazole-5-carboxylate?
The IUPAC name of methyl 4-amino-1,3-dimethylpyrazole-5-carboxylate (CID 20715109) is methyl 4-amino-1,3-dimethylpyrazole-5-carboxylate.
What is the SMILES notation for methyl 4-amino-1,3-dimethylpyrazole-5-carboxylate?
The canonical SMILES for methyl 4-amino-1,3-dimethylpyrazole-5-carboxylate is COC(=O)c1c(N)c(C)nn1C.
What is the InChIKey of methyl 4-amino-1,3-dimethylpyrazole-5-carboxylate?
The InChIKey is PUTMXTILUKFDHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O2/c1-4-5(8)6(7(11)12-3)10(2)9-4/h8H2,1-3H3.
What are the key properties of methyl 4-amino-1,3-dimethylpyrazole-5-carboxylate?
methyl 4-amino-1,3-dimethylpyrazole-5-carboxylate has a molecular weight of 169.18 g/mol, XLogP of 0.10, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-amino-1,3-dimethylpyrazole-5-carboxylate is sourced from PubChem (CID 20715109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).