About 2,3-dimethoxy-N,N'-bis(prop-2-enyl)butanediamide
2,3-dimethoxy-N,N'-bis(prop-2-enyl)butanediamide (PubChem CID 20715374) has the molecular formula C12H20N2O4
and a molecular weight of 256.30 g/mol. Its IUPAC name is 2,3-dimethoxy-N,N'-bis(prop-2-enyl)butanediamide.
Molecular Properties
| Compound Name | 2,3-dimethoxy-N,N'-bis(prop-2-enyl)butanediamide |
| PubChem CID | 20715374 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 2,3-dimethoxy-N,N'-bis(prop-2-enyl)butanediamide |
| SMILES | C=CCNC(=O)C(OC)C(OC)C(=O)NCC=C |
| InChI | InChI=1S/C12H20N2O4/c1-5-7-13-11(15)9(17-3)10(18-4)12(16)14-8-6-2/h5-6,9-10H,1-2,7-8H2,3-4H3,(H,13,15)(H,14,16) |
| InChIKey | LVTQBTZCLUQOOW-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethoxy-N,N'-bis(prop-2-enyl)butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethoxy-N,N'-bis(prop-2-enyl)butanediamide?
The IUPAC name of 2,3-dimethoxy-N,N'-bis(prop-2-enyl)butanediamide (CID 20715374) is 2,3-dimethoxy-N,N'-bis(prop-2-enyl)butanediamide.
What is the SMILES notation for 2,3-dimethoxy-N,N'-bis(prop-2-enyl)butanediamide?
The canonical SMILES for 2,3-dimethoxy-N,N'-bis(prop-2-enyl)butanediamide is C=CCNC(=O)C(OC)C(OC)C(=O)NCC=C.
What is the InChIKey of 2,3-dimethoxy-N,N'-bis(prop-2-enyl)butanediamide?
The InChIKey is LVTQBTZCLUQOOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O4/c1-5-7-13-11(15)9(17-3)10(18-4)12(16)14-8-6-2/h5-6,9-10H,1-2,7-8H2,3-4H3,(H,13,15)(H,14,16).
What are the key properties of 2,3-dimethoxy-N,N'-bis(prop-2-enyl)butanediamide?
2,3-dimethoxy-N,N'-bis(prop-2-enyl)butanediamide has a molecular weight of 256.30 g/mol, XLogP of -0.38, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethoxy-N,N'-bis(prop-2-enyl)butanediamide is sourced from PubChem (CID 20715374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).