About 2-(1,2-dimethyl-4-oxoazetidin-3-yl)ethanimidamide
2-(1,2-dimethyl-4-oxoazetidin-3-yl)ethanimidamide (PubChem CID 20715800) has the molecular formula C7H13N3O
and a molecular weight of 155.20 g/mol. Its IUPAC name is 2-(1,2-dimethyl-4-oxoazetidin-3-yl)ethanimidamide.
Molecular Properties
| Compound Name | 2-(1,2-dimethyl-4-oxoazetidin-3-yl)ethanimidamide |
| PubChem CID | 20715800 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 2-(1,2-dimethyl-4-oxoazetidin-3-yl)ethanimidamide |
| SMILES | [H]/N=C(\N)CC1C(=O)N(C)C1C |
| InChI | InChI=1S/C7H13N3O/c1-4-5(3-6(8)9)7(11)10(4)2/h4-5H,3H2,1-2H3,(H3,8,9) |
| InChIKey | PPTPYHSUVJMBGZ-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 70.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,2-dimethyl-4-oxoazetidin-3-yl)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2-dimethyl-4-oxoazetidin-3-yl)ethanimidamide?
The IUPAC name of 2-(1,2-dimethyl-4-oxoazetidin-3-yl)ethanimidamide (CID 20715800) is 2-(1,2-dimethyl-4-oxoazetidin-3-yl)ethanimidamide.
What is the SMILES notation for 2-(1,2-dimethyl-4-oxoazetidin-3-yl)ethanimidamide?
The canonical SMILES for 2-(1,2-dimethyl-4-oxoazetidin-3-yl)ethanimidamide is [H]/N=C(\N)CC1C(=O)N(C)C1C.
What is the InChIKey of 2-(1,2-dimethyl-4-oxoazetidin-3-yl)ethanimidamide?
The InChIKey is PPTPYHSUVJMBGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O/c1-4-5(3-6(8)9)7(11)10(4)2/h4-5H,3H2,1-2H3,(H3,8,9).
What are the key properties of 2-(1,2-dimethyl-4-oxoazetidin-3-yl)ethanimidamide?
2-(1,2-dimethyl-4-oxoazetidin-3-yl)ethanimidamide has a molecular weight of 155.20 g/mol, XLogP of -0.21, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-dimethyl-4-oxoazetidin-3-yl)ethanimidamide is sourced from PubChem (CID 20715800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).